ChemNet > CAS > 368869-85-6 1-[4-(bromomethyl)phenyl]-1H-pyrazole
368869-85-6 1-[4-(bromomethyl)phenyl]-1H-pyrazole
| Nama produk |
1-[4-(bromomethyl)phenyl]-1H-pyrazole |
| Nama Inggeris |
1-[4-(bromomethyl)phenyl]-1H-pyrazole; |
| MF |
C10H9BrN2 |
| Berat Molekul |
237.0959 |
| InChI |
InChI=1/C10H9BrN2/c11-8-9-2-4-10(5-3-9)13-7-1-6-12-13/h1-7H,8H2 |
| CAS NO |
368869-85-6 |
| Struktur Molekul |
|
| Kepadatan |
1.44g/cm3 |
| Titik lebur |
77℃ |
| Titik didih |
315.3°C at 760 mmHg |
| Indeks bias |
1.623 |
| Titik nyala |
144.5°C |
| Tekanan wap |
0.000816mmHg at 25°C |
| Cinta bahaya |
C:Corrosive;
|
| Kod Risiko |
R34:Causes burns.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|